C19H32O3S — CID 88947585
(10Z,13S)-14-methoxy-10,12-dimethyl-13-sulfanyloxyhexadeca-1,10,15-trien-7-one (PubChem CID 88947585) has the molecular formula C19H32O3S and a molecular weight of 340.53 g/mol. Its IUPAC name is (10Z,13S)-14-methoxy-10,12-dimethyl-13-sulfanyloxyhexadeca-1,10,15-trien-7-one.
| Compound Name | (10Z,13S)-14-methoxy-10,12-dimethyl-13-sulfanyloxyhexadeca-1,10,15-trien-7-one |
|---|---|
| PubChem CID | 88947585 |
| Molecular Formula | C19H32O3S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (10Z,13S)-14-methoxy-10,12-dimethyl-13-sulfanyloxyhexadeca-1,10,15-trien-7-one |
| SMILES | C=CCCCCC(=O)CC/C(C)=C\C(C)[C@H](OS)C(C=C)OC |
| InChI | InChI=1S/C19H32O3S/c1-6-8-9-10-11-17(20)13-12-15(3)14-16(4)19(22-23)18(7-2)21-5/h6-7,14,16,18-19,23H,1-2,8-13H2,3-5H3/b15-14-/t16?,18?,19-/m0/s1 |
| InChIKey | HRUIBLLOOSIPEB-WZXSKGFKSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|