C18H30O4S — CID 89382936
[(2Z,4R,5S,6S)-6-methoxy-2,4-dimethyl-5-sulfanyloxyocta-2,7-dienyl] hept-6-enoate (PubChem CID 89382936) has the molecular formula C18H30O4S and a molecular weight of 342.50 g/mol. Its IUPAC name is [(2Z,4R,5S,6S)-6-methoxy-2,4-dimethyl-5-sulfanyloxyocta-2,7-dienyl] hept-6-enoate.
| Compound Name | [(2Z,4R,5S,6S)-6-methoxy-2,4-dimethyl-5-sulfanyloxyocta-2,7-dienyl] hept-6-enoate |
|---|---|
| PubChem CID | 89382936 |
| Molecular Formula | C18H30O4S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(2Z,4R,5S,6S)-6-methoxy-2,4-dimethyl-5-sulfanyloxyocta-2,7-dienyl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC/C(C)=C\[C@@H](C)[C@H](OS)[C@H](C=C)OC |
| InChI | InChI=1S/C18H30O4S/c1-6-8-9-10-11-17(19)21-13-14(3)12-15(4)18(22-23)16(7-2)20-5/h6-7,12,15-16,18,23H,1-2,8-11,13H2,3-5H3/b14-12-/t15-,16+,18+/m1/s1 |
| InChIKey | HKBZSNDEXLSSGQ-RPSXDALUSA-N |
| XLogP | 4.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|