About azane;2-methoxyethyl undec-10-enoate
azane;2-methoxyethyl undec-10-enoate (PubChem CID 174560084) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is azane;2-methoxyethyl undec-10-enoate.
Molecular Properties
| Compound Name | azane;2-methoxyethyl undec-10-enoate |
| PubChem CID | 174560084 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | azane;2-methoxyethyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCCOC.N |
| InChI | InChI=1S/C14H26O3.H3N/c1-3-4-5-6-7-8-9-10-11-14(15)17-13-12-16-2;/h3H,1,4-13H2,2H3;1H3 |
| InChIKey | BQOQCZZUVVGUBX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methoxyethyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methoxyethyl undec-10-enoate?
The IUPAC name of azane;2-methoxyethyl undec-10-enoate (CID 174560084) is azane;2-methoxyethyl undec-10-enoate.
What is the SMILES notation for azane;2-methoxyethyl undec-10-enoate?
The canonical SMILES for azane;2-methoxyethyl undec-10-enoate is C=CCCCCCCCCC(=O)OCCOC.N.
What is the InChIKey of azane;2-methoxyethyl undec-10-enoate?
The InChIKey is BQOQCZZUVVGUBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3.H3N/c1-3-4-5-6-7-8-9-10-11-14(15)17-13-12-16-2;/h3H,1,4-13H2,2H3;1H3.
What are the key properties of azane;2-methoxyethyl undec-10-enoate?
azane;2-methoxyethyl undec-10-enoate has a molecular weight of 259.39 g/mol, XLogP of 3.64, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methoxyethyl undec-10-enoate is sourced from PubChem (CID 174560084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).