About but-3-en-2-yl undec-10-enoate
but-3-en-2-yl undec-10-enoate (PubChem CID 141164752) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is but-3-en-2-yl undec-10-enoate.
Molecular Properties
| Compound Name | but-3-en-2-yl undec-10-enoate |
| PubChem CID | 141164752 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | but-3-en-2-yl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC(C)C=C |
| InChI | InChI=1S/C15H26O2/c1-4-6-7-8-9-10-11-12-13-15(16)17-14(3)5-2/h4-5,14H,1-2,6-13H2,3H3 |
| InChIKey | SAJLINCSQHEBDM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-yl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-yl undec-10-enoate?
The IUPAC name of but-3-en-2-yl undec-10-enoate (CID 141164752) is but-3-en-2-yl undec-10-enoate.
What is the SMILES notation for but-3-en-2-yl undec-10-enoate?
The canonical SMILES for but-3-en-2-yl undec-10-enoate is C=CCCCCCCCCC(=O)OC(C)C=C.
What is the InChIKey of but-3-en-2-yl undec-10-enoate?
The InChIKey is SAJLINCSQHEBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-4-6-7-8-9-10-11-12-13-15(16)17-14(3)5-2/h4-5,14H,1-2,6-13H2,3H3.
What are the key properties of but-3-en-2-yl undec-10-enoate?
but-3-en-2-yl undec-10-enoate has a molecular weight of 238.37 g/mol, XLogP of 4.41, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yl undec-10-enoate is sourced from PubChem (CID 141164752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).