C35H57NO7Si — CID 91323355
[(5S,9R,10S,11S)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,6-dioxopiperidin-4-yl)-11-methoxy-5,7,9-trimethyl-4-oxotrideca-7,12-dien-6-yl] hepta-3,6-dienoate (PubChem CID 91323355) has the molecular formula C35H57NO7Si and a molecular weight of 631.93 g/mol. Its IUPAC name is [(5S,9R,10S,11S)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,6-dioxopiperidin-4-yl)-11-methoxy-5,7,9-trimethyl-4-oxotrideca-7,12-dien-6-yl] hepta-3,6-dienoate.
| Compound Name | [(5S,9R,10S,11S)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,6-dioxopiperidin-4-yl)-11-methoxy-5,7,9-trimethyl-4-oxotrideca-7,12-dien-6-yl] hepta-3,6-dienoate |
|---|---|
| PubChem CID | 91323355 |
| Molecular Formula | C35H57NO7Si |
| Molecular Weight | 631.93 g/mol |
| Exact Mass | 631.39 |
| IUPAC Name | [(5S,9R,10S,11S)-10-[tert-butyl(dimethyl)silyl]oxy-1-(2,6-dioxopiperidin-4-yl)-11-methoxy-5,7,9-trimethyl-4-oxotrideca-7,12-dien-6-yl] hepta-3,6-dienoate |
| SMILES | C=CCC=CCC(=O)OC(C(C)=C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)OC)[C@H](C)C(=O)CCCC1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C35H57NO7Si/c1-12-14-15-16-20-32(40)42-33(26(5)28(37)19-17-18-27-22-30(38)36-31(39)23-27)24(3)21-25(4)34(29(13-2)41-9)43-44(10,11)35(6,7)8/h12-13,15-16,21,25-27,29,33-34H,1-2,14,17-20,22-23H2,3-11H3,(H,36,38,39)/t25-,26-,29+,33?,34+/m1/s1 |
| InChIKey | IFPIOSGRTHZLGO-NFASJGIYSA-N |
| XLogP | 7.02 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.93 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|