C27H39NO6 — CID 142948672
[(Z,6R,9S)-1-(2,6-dioxopiperidin-4-yl)-11-hydroxy-7,9-dimethyl-4-oxotridec-7-en-12-yn-6-yl] hept-6-enoate (PubChem CID 142948672) has the molecular formula C27H39NO6 and a molecular weight of 473.61 g/mol. Its IUPAC name is [(Z,6R,9S)-1-(2,6-dioxopiperidin-4-yl)-11-hydroxy-7,9-dimethyl-4-oxotridec-7-en-12-yn-6-yl] hept-6-enoate.
| Compound Name | [(Z,6R,9S)-1-(2,6-dioxopiperidin-4-yl)-11-hydroxy-7,9-dimethyl-4-oxotridec-7-en-12-yn-6-yl] hept-6-enoate |
|---|---|
| PubChem CID | 142948672 |
| Molecular Formula | C27H39NO6 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | [(Z,6R,9S)-1-(2,6-dioxopiperidin-4-yl)-11-hydroxy-7,9-dimethyl-4-oxotridec-7-en-12-yn-6-yl] hept-6-enoate |
| SMILES | C#CC(O)C[C@H](C)/C=C(/C)[C@@H](CC(=O)CCCC1CC(=O)NC(=O)C1)OC(=O)CCCCC=C |
| InChI | InChI=1S/C27H39NO6/c1-5-7-8-9-13-27(33)34-24(20(4)14-19(3)15-22(29)6-2)18-23(30)12-10-11-21-16-25(31)28-26(32)17-21/h2,5,14,19,21-22,24,29H,1,7-13,15-18H2,3-4H3,(H,28,31,32)/b20-14-/t19-,22?,24-/m1/s1 |
| InChIKey | RGUAKVJWSLEGDY-GHFXPZDMSA-N |
| XLogP | 3.79 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|