C25H54O3Si3 — CID 10672598
[(1R,4S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10672598) has the molecular formula C25H54O3Si3 and a molecular weight of 486.96 g/mol. Its IUPAC name is [(1R,4S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10672598 |
| Molecular Formula | C25H54O3Si3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | [(1R,4S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O3Si3/c1-23(2,3)29(10,11)26-19-20-16-17-21(27-30(12,13)24(4,5)6)18-22(20)28-31(14,15)25(7,8)9/h16-17,20-22H,18-19H2,1-15H3/t20-,21-,22+/m1/s1 |
| InChIKey | GOINCCTYJBLADM-VSKRKVRLSA-N |
| XLogP | 8.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|