C23H48O2Si2 — CID 134960246
tert-butyl-[(5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyldeca-6,9-dienoxy]-dimethylsilane (PubChem CID 134960246) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is tert-butyl-[(5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyldeca-6,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyldeca-6,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134960246 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-[(5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyldeca-6,9-dienoxy]-dimethylsilane |
| SMILES | C=CC/C(C)=C/[C@@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-13-16-20(2)19-21(25-27(11,12)23(6,7)8)17-14-15-18-24-26(9,10)22(3,4)5/h13,19,21H,1,14-18H2,2-12H3/b20-19+/t21-/m1/s1 |
| InChIKey | GUFYEKISJLPKEJ-RABMLOOZSA-N |
| XLogP | 8.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|