C32H60O2Si2 — CID 134930766
[(2E,11E)-7,16-dimethylidene-10-triethylsilyloxycyclooctadeca-2,11-dien-1-yl]oxy-triethylsilane (PubChem CID 134930766) has the molecular formula C32H60O2Si2 and a molecular weight of 533.00 g/mol. Its IUPAC name is [(2E,11E)-7,16-dimethylidene-10-triethylsilyloxycyclooctadeca-2,11-dien-1-yl]oxy-triethylsilane.
| Compound Name | [(2E,11E)-7,16-dimethylidene-10-triethylsilyloxycyclooctadeca-2,11-dien-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134930766 |
| Molecular Formula | C32H60O2Si2 |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | [(2E,11E)-7,16-dimethylidene-10-triethylsilyloxycyclooctadeca-2,11-dien-1-yl]oxy-triethylsilane |
| SMILES | C=C1CCC/C=C/C(O[Si](CC)(CC)CC)CCC(=C)CCC/C=C/C(O[Si](CC)(CC)CC)CC1 |
| InChI | InChI=1S/C32H60O2Si2/c1-9-35(10-2,11-3)33-31-23-19-15-17-22-30(8)26-28-32(34-36(12-4,13-5)14-6)24-20-16-18-21-29(7)25-27-31/h19-20,23-24,31-32H,7-18,21-22,25-28H2,1-6H3/b23-19+,24-20+ |
| InChIKey | SJKUZSNFXAXTPU-BLVCXSLXSA-N |
| XLogP | 10.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|