C21H42O2Si — CID 91710972
[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-nonoxysilane (PubChem CID 91710972) has the molecular formula C21H42O2Si and a molecular weight of 354.65 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-nonoxysilane.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-nonoxysilane |
|---|---|
| PubChem CID | 91710972 |
| Molecular Formula | C21H42O2Si |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.30 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethyl-nonoxysilane |
| SMILES | CCCCCCCCCO[Si](C)(C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H42O2Si/c1-7-8-9-10-11-12-13-18-22-24(5,6)23-19-17-21(4)16-14-15-20(2)3/h15,17H,7-14,16,18-19H2,1-6H3/b21-17+ |
| InChIKey | VNTGJFDVQHEZHD-HEHNFIMWSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|