C34H70O3Si3 — CID 134960457
[(E,1R,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1-(2-methylidenepent-4-enyl)non-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 134960457) has the molecular formula C34H70O3Si3 and a molecular weight of 611.19 g/mol. Its IUPAC name is [(E,1R,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1-(2-methylidenepent-4-enyl)non-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,1R,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1-(2-methylidenepent-4-enyl)non-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134960457 |
| Molecular Formula | C34H70O3Si3 |
| Molecular Weight | 611.19 g/mol |
| Exact Mass | 610.46 |
| IUPAC Name | [(E,1R,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-1-(2-methylidenepent-4-enyl)non-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CCC(=C)C[C@H](C/C(C)=C/[C@@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H70O3Si3/c1-19-22-28(2)25-31(37-40(17,18)34(10,11)12)27-29(3)26-30(36-39(15,16)33(7,8)9)23-20-21-24-35-38(13,14)32(4,5)6/h19,26,30-31H,1-2,20-25,27H2,3-18H3/b29-26+/t30-,31-/m1/s1 |
| InChIKey | NXCVWHDMKVXYEN-VUHFHDFDSA-N |
| XLogP | 11.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.19 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|