C28H56O2Si2 — CID 135066594
[(2E,12E)-3,12-dimethyl-11-triethylsilyloxytetradeca-2,7,12-trien-4-yl]oxy-triethylsilane (PubChem CID 135066594) has the molecular formula C28H56O2Si2 and a molecular weight of 480.93 g/mol. Its IUPAC name is [(2E,12E)-3,12-dimethyl-11-triethylsilyloxytetradeca-2,7,12-trien-4-yl]oxy-triethylsilane.
| Compound Name | [(2E,12E)-3,12-dimethyl-11-triethylsilyloxytetradeca-2,7,12-trien-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 135066594 |
| Molecular Formula | C28H56O2Si2 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | [(2E,12E)-3,12-dimethyl-11-triethylsilyloxytetradeca-2,7,12-trien-4-yl]oxy-triethylsilane |
| SMILES | C/C=C(\C)C(CCC=CCCC(O[Si](CC)(CC)CC)/C(C)=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H56O2Si2/c1-11-25(9)27(29-31(13-3,14-4)15-5)23-21-19-20-22-24-28(26(10)12-2)30-32(16-6,17-7)18-8/h11-12,19-20,27-28H,13-18,21-24H2,1-10H3/b20-19?,25-11+,26-12+ |
| InChIKey | IZQOCXRISLYNPW-HZXNRKIQSA-N |
| XLogP | 9.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|