C28H62O2Si3 — CID 135059486
tert-butyl-dimethyl-[(1S)-1-[(Z,1S)-2-trimethylsilyl-1-tri(propan-2-yl)silyloxybut-2-enyl]hexoxy]silane (PubChem CID 135059486) has the molecular formula C28H62O2Si3 and a molecular weight of 515.06 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-1-[(Z,1S)-2-trimethylsilyl-1-tri(propan-2-yl)silyloxybut-2-enyl]hexoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S)-1-[(Z,1S)-2-trimethylsilyl-1-tri(propan-2-yl)silyloxybut-2-enyl]hexoxy]silane |
|---|---|
| PubChem CID | 135059486 |
| Molecular Formula | C28H62O2Si3 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-1-[(Z,1S)-2-trimethylsilyl-1-tri(propan-2-yl)silyloxybut-2-enyl]hexoxy]silane |
| SMILES | C/C=C(/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C28H62O2Si3/c1-17-19-20-21-25(29-32(15,16)28(9,10)11)27(26(18-2)31(12,13)14)30-33(22(3)4,23(5)6)24(7)8/h18,22-25,27H,17,19-21H2,1-16H3/b26-18-/t25-,27-/m0/s1 |
| InChIKey | KMAPPVMCZMDSKD-XGWYUUAQSA-N |
| XLogP | 10.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|