C29H62O2Si2 — CID 25258171
tert-butyl-[(Z,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxyheptadec-8-en-2-yl]oxy-dimethylsilane (PubChem CID 25258171) has the molecular formula C29H62O2Si2 and a molecular weight of 498.99 g/mol. Its IUPAC name is tert-butyl-[(Z,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxyheptadec-8-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxyheptadec-8-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 25258171 |
| Molecular Formula | C29H62O2Si2 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.43 |
| IUPAC Name | tert-butyl-[(Z,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxyheptadec-8-en-2-yl]oxy-dimethylsilane |
| SMILES | CCCCCCCC/C=C\C[C@H](CCC[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H62O2Si2/c1-13-14-15-16-17-18-19-20-21-24-27(31-33(11,12)29(6,7)8)25-22-23-26(2)30-32(9,10)28(3,4)5/h20-21,26-27H,13-19,22-25H2,1-12H3/b21-20-/t26-,27-/m1/s1 |
| InChIKey | DVHYLYYKVKRTCQ-OGDNVMKQSA-N |
| XLogP | 10.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|