C24H46OSi2 — CID 135068814
[(2E)-1-(cyclohexen-1-yl)-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane (PubChem CID 135068814) has the molecular formula C24H46OSi2 and a molecular weight of 406.80 g/mol. Its IUPAC name is [(2E)-1-(cyclohexen-1-yl)-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane.
| Compound Name | [(2E)-1-(cyclohexen-1-yl)-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane |
|---|---|
| PubChem CID | 135068814 |
| Molecular Formula | C24H46OSi2 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | [(2E)-1-(cyclohexen-1-yl)-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane |
| SMILES | C=CC/C(=C\C(O[Si](CC)(CC)CC)C1=CCCCC1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H46OSi2/c1-8-18-23(26(9-2,10-3)11-4)21-24(22-19-16-15-17-20-22)25-27(12-5,13-6)14-7/h8,19,21,24H,1,9-18,20H2,2-7H3/b23-21+ |
| InChIKey | ROKFDAFXZBIKDA-XTQSDGFTSA-N |
| XLogP | 8.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|