C25H50O3Si3 — CID 154711642
tert-butyl-dimethyl-[2-[3-methyl-4-triethylsilyloxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane (PubChem CID 154711642) has the molecular formula C25H50O3Si3 and a molecular weight of 482.93 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[3-methyl-4-triethylsilyloxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[3-methyl-4-triethylsilyloxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane |
|---|---|
| PubChem CID | 154711642 |
| Molecular Formula | C25H50O3Si3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | tert-butyl-dimethyl-[2-[3-methyl-4-triethylsilyloxy-2-(2-trimethylsilylethynyl)-3,6-dihydro-2H-pyran-6-yl]ethoxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=CC(CCO[Si](C)(C)C(C)(C)C)OC(C#C[Si](C)(C)C)C1C |
| InChI | InChI=1S/C25H50O3Si3/c1-13-31(14-2,15-3)28-24-20-22(16-18-26-30(11,12)25(5,6)7)27-23(21(24)4)17-19-29(8,9)10/h20-23H,13-16,18H2,1-12H3 |
| InChIKey | JWMMDHVQYSMJTB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|