C19H40O3Si2 — CID 101143682
tert-butyl-dimethyl-[[(2S,6S)-6-methyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]silane (PubChem CID 101143682) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,6S)-6-methyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,6S)-6-methyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 101143682 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,6S)-6-methyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H](C)O[C@H](CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H40O3Si2/c1-10-24(11-2,12-3)22-17-13-16(4)21-18(14-17)15-20-23(8,9)19(5,6)7/h13,16,18H,10-12,14-15H2,1-9H3/t16-,18-/m0/s1 |
| InChIKey | OVIYOIOCKPQPEK-WMZOPIPTSA-N |
| XLogP | 6.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|