C19H36O3Si2 — CID 11257174
tert-butyl-dimethyl-[[(1R,2R,5S)-3-triethylsilyloxy-8-oxabicyclo[3.2.1]octa-3,6-dien-2-yl]oxy]silane (PubChem CID 11257174) has the molecular formula C19H36O3Si2 and a molecular weight of 368.67 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,5S)-3-triethylsilyloxy-8-oxabicyclo[3.2.1]octa-3,6-dien-2-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,5S)-3-triethylsilyloxy-8-oxabicyclo[3.2.1]octa-3,6-dien-2-yl]oxy]silane |
|---|---|
| PubChem CID | 11257174 |
| Molecular Formula | C19H36O3Si2 |
| Molecular Weight | 368.67 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,5S)-3-triethylsilyloxy-8-oxabicyclo[3.2.1]octa-3,6-dien-2-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@@H]2C=C[C@@H](O2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si2/c1-9-24(10-2,11-3)21-17-14-15-12-13-16(20-15)18(17)22-23(7,8)19(4,5)6/h12-16,18H,9-11H2,1-8H3/t15-,16+,18+/m0/s1 |
| InChIKey | RRYRTBFSLAPWKZ-LZLYRXPVSA-N |
| XLogP | 5.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|