C13H22O2Si — CID 10657595
triethyl-[[(1R,5R)-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]oxy]silane (PubChem CID 10657595) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is triethyl-[[(1R,5R)-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]oxy]silane.
| Compound Name | triethyl-[[(1R,5R)-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]oxy]silane |
|---|---|
| PubChem CID | 10657595 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | triethyl-[[(1R,5R)-8-oxabicyclo[3.2.1]octa-2,6-dien-3-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H]2C=C[C@@H](C1)O2 |
| InChI | InChI=1S/C13H22O2Si/c1-4-16(5-2,6-3)15-13-9-11-7-8-12(10-13)14-11/h7-9,11-12H,4-6,10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | JNINITZODOFXAF-NEPJUHHUSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|