C27H56O4Si3 — CID 134930722
[(2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134930722) has the molecular formula C27H56O4Si3 and a molecular weight of 529.00 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134930722 |
| Molecular Formula | C27H56O4Si3 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-prop-2-enyl-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H56O4Si3/c1-17-18-21-19-22(30-33(13,14)26(5,6)7)24(31-34(15,16)27(8,9)10)23(29-21)20-28-32(11,12)25(2,3)4/h17,19,22-24H,1,18,20H2,2-16H3/t22-,23-,24+/m1/s1 |
| InChIKey | FCGLMUCQPWZVNZ-SMIHKQSGSA-N |
| XLogP | 8.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|