C20H38O3Si2 — CID 11429013
tert-butyl-[[(2R,6S)-6-ethynyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane (PubChem CID 11429013) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is tert-butyl-[[(2R,6S)-6-ethynyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,6S)-6-ethynyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11429013 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | tert-butyl-[[(2R,6S)-6-ethynyl-4-triethylsilyloxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
| SMILES | C#C[C@@H]1C=C(O[Si](CC)(CC)CC)C[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H38O3Si2/c1-10-17-14-18(23-25(11-2,12-3)13-4)15-19(22-17)16-21-24(8,9)20(5,6)7/h1,14,17,19H,11-13,15-16H2,2-9H3/t17-,19-/m1/s1 |
| InChIKey | IZJYJDKENSVGBV-IEBWSBKVSA-N |
| XLogP | 5.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|