C23H42O2Si — CID 161097710
tert-butyl-dimethyl-[(2E,4S,6S,8Z)-5,5,6-trimethyl-9-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]nona-2,8-dien-4-yl]oxysilane (PubChem CID 161097710) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4S,6S,8Z)-5,5,6-trimethyl-9-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]nona-2,8-dien-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2E,4S,6S,8Z)-5,5,6-trimethyl-9-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]nona-2,8-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 161097710 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4S,6S,8Z)-5,5,6-trimethyl-9-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]nona-2,8-dien-4-yl]oxysilane |
| SMILES | C/C=C/[C@@H]1O[C@@H]1/C=C\C[C@H](C)C(C)(C)[C@H](/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-11-14-19-20(24-19)17-13-16-18(3)23(7,8)21(15-12-2)25-26(9,10)22(4,5)6/h11-15,17-21H,16H2,1-10H3/b14-11+,15-12+,17-13-/t18-,19-,20+,21-/m0/s1 |
| InChIKey | ZCLTZIWTQWLAGI-XEYMYUCESA-N |
| XLogP | 6.91 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|