C21H40O3Si — CID 11810732
tert-butyl-[(2S)-2-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]but-3-en-2-yl]oxy-dimethylsilane (PubChem CID 11810732) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]but-3-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]but-3-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11810732 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]but-3-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@](C)(O[Si](C)(C)C(C)(C)C)[C@@]1([C@@H](C)C/C=C/C(C)(C)OC)CO1 |
| InChI | InChI=1S/C21H40O3Si/c1-12-20(8,24-25(10,11)18(3,4)5)21(16-23-21)17(2)14-13-15-19(6,7)22-9/h12-13,15,17H,1,14,16H2,2-11H3/b15-13+/t17-,20-,21-/m0/s1 |
| InChIKey | MOKNVVIAXXLFES-SXMJTNQVSA-N |
| XLogP | 5.73 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|