C19H34O2Si — CID 101079232
tert-butyl-[(E)-5-[(1S,2R)-2-ethenyl-1-methoxycyclopent-3-en-1-yl]pent-4-enoxy]-dimethylsilane (PubChem CID 101079232) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[(1S,2R)-2-ethenyl-1-methoxycyclopent-3-en-1-yl]pent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-5-[(1S,2R)-2-ethenyl-1-methoxycyclopent-3-en-1-yl]pent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101079232 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl-[(E)-5-[(1S,2R)-2-ethenyl-1-methoxycyclopent-3-en-1-yl]pent-4-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1C=CC[C@@]1(/C=C/CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C19H34O2Si/c1-8-17-13-12-15-19(17,20-5)14-10-9-11-16-21-22(6,7)18(2,3)4/h8,10,12-14,17H,1,9,11,15-16H2,2-7H3/b14-10+/t17-,19-/m1/s1 |
| InChIKey | OMGRHDJCAUBJSP-MDSZXXSUSA-N |
| XLogP | 5.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|