C25H50O2SiSn — CID 11005933
[(E)-4-[(2-methylpropan-2-yl)oxy]-2-[(1R)-3-trimethylstannylcyclopent-3-en-1-yl]but-2-enoxy]-tri(propan-2-yl)silane (PubChem CID 11005933) has the molecular formula C25H50O2SiSn and a molecular weight of 529.47 g/mol. Its IUPAC name is [(E)-4-[(2-methylpropan-2-yl)oxy]-2-[(1R)-3-trimethylstannylcyclopent-3-en-1-yl]but-2-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-4-[(2-methylpropan-2-yl)oxy]-2-[(1R)-3-trimethylstannylcyclopent-3-en-1-yl]but-2-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11005933 |
| Molecular Formula | C25H50O2SiSn |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | [(E)-4-[(2-methylpropan-2-yl)oxy]-2-[(1R)-3-trimethylstannylcyclopent-3-en-1-yl]but-2-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC/C(=C/COC(C)(C)C)[C@@H]1CC=C([Sn](C)(C)C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H41O2Si.3CH3.Sn/c1-17(2)25(18(3)4,19(5)6)24-16-21(20-12-10-11-13-20)14-15-23-22(7,8)9;;;;/h10,14,17-20H,12-13,15-16H2,1-9H3;3*1H3;/b21-14-;;;;/t20-;;;;/m1..../s1 |
| InChIKey | GEXYGQGDMKNTBP-DMIVFHAISA-N |
| XLogP | 8.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|