C26H52O3Si2 — CID 162415651
tri(propan-2-yl)-[[3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy]silane (PubChem CID 162415651) has the molecular formula C26H52O3Si2 and a molecular weight of 468.87 g/mol. Its IUPAC name is tri(propan-2-yl)-[[3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy]silane.
| Compound Name | tri(propan-2-yl)-[[3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 162415651 |
| Molecular Formula | C26H52O3Si2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | tri(propan-2-yl)-[[3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy]silane |
| SMILES | CC(C)[Si](OCC1C2C=CC(O2)C1CO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H52O3Si2/c1-17(2)30(18(3)4,19(5)6)27-15-23-24(26-14-13-25(23)29-26)16-28-31(20(7)8,21(9)10)22(11)12/h13-14,17-26H,15-16H2,1-12H3 |
| InChIKey | OCPAODFQROHYLH-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|