C27H54O3Si2 — CID 15174750
[(1S,2S,3R,4R)-1-methyl-3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 15174750) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-1-methyl-3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,2S,3R,4R)-1-methyl-3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15174750 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | [(1S,2S,3R,4R)-1-methyl-3-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC[C@H]1[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@]2(C)C=C[C@H]1O2)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H54O3Si2/c1-18(2)31(19(3)4,20(5)6)28-16-24-25(27(13)15-14-26(24)30-27)17-29-32(21(7)8,22(9)10)23(11)12/h14-15,18-26H,16-17H2,1-13H3/t24-,25+,26+,27-/m0/s1 |
| InChIKey | PCIDEXBTENGPON-YAOOYPAMSA-N |
| XLogP | 8.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|