C23H48O2Si2 — CID 91433527
tert-butyl-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-5,7-dienoxy]-dimethylsilane (PubChem CID 91433527) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is tert-butyl-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-5,7-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-5,7-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 91433527 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | tert-butyl-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-5,7-dienoxy]-dimethylsilane |
| SMILES | CC=CC(C)=C[C@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-14-15-19(2)18-20(3)21(25-27(12,13)23(7,8)9)16-17-24-26(10,11)22(4,5)6/h14-15,18,20-21H,16-17H2,1-13H3/t20-,21-/m0/s1 |
| InChIKey | NESPPNSEPDKACA-SFTDATJTSA-N |
| XLogP | 7.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|