C18H32OSi — CID 102150886
[(5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 102150886) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102150886 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C/C=C/C(/C=C/C=C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32OSi/c1-8-10-13-17(14-11-9-2)15-12-16-19-20(6,7)18(3,4)5/h8-11,13-14,17H,1-2,12,15-16H2,3-7H3/b13-10+,14-11+ |
| InChIKey | AKBBGSGHLYPFLU-IFQMDVHZSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|