C16H34OSi — CID 14336178
tert-butyl-[(3R)-3,7-dimethyloct-6-enoxy]-dimethylsilane (PubChem CID 14336178) has the molecular formula C16H34OSi and a molecular weight of 270.53 g/mol. Its IUPAC name is tert-butyl-[(3R)-3,7-dimethyloct-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R)-3,7-dimethyloct-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 14336178 |
| Molecular Formula | C16H34OSi |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | tert-butyl-[(3R)-3,7-dimethyloct-6-enoxy]-dimethylsilane |
| SMILES | CC(C)=CCC[C@@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34OSi/c1-14(2)10-9-11-15(3)12-13-17-18(7,8)16(4,5)6/h10,15H,9,11-13H2,1-8H3/t15-/m1/s1 |
| InChIKey | NFSXVFBFWBTHLM-OAHLLOKOSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|