C31H68O2Si2Sn — CID 11700228
tert-butyl-[(E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tributylstannylhex-5-enoxy]-dimethylsilane (PubChem CID 11700228) has the molecular formula C31H68O2Si2Sn and a molecular weight of 647.77 g/mol. Its IUPAC name is tert-butyl-[(E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tributylstannylhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tributylstannylhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11700228 |
| Molecular Formula | C31H68O2Si2Sn |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | tert-butyl-[(E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-tributylstannylhex-5-enoxy]-dimethylsilane |
| SMILES | CCCC[Sn](/C=C/[C@@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C19H41O2Si2.3C4H9.Sn/c1-13-16(2)17(21-23(11,12)19(6,7)8)14-15-20-22(9,10)18(3,4)5;3*1-3-4-2;/h1,13,16-17H,14-15H2,2-12H3;3*1,3-4H2,2H3;/t16-,17+;;;;/m1..../s1 |
| InChIKey | KEJGJDRPYLUPDH-PNNYBRIFSA-N |
| XLogP | 11.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|