C26H54O2SiSn — CID 138969960
tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E,2S)-4-tributylstannylbut-3-en-2-yl]oxiran-2-yl]methoxy]silane (PubChem CID 138969960) has the molecular formula C26H54O2SiSn and a molecular weight of 545.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E,2S)-4-tributylstannylbut-3-en-2-yl]oxiran-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E,2S)-4-tributylstannylbut-3-en-2-yl]oxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 138969960 |
| Molecular Formula | C26H54O2SiSn |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,3S)-2-methyl-3-[(E,2S)-4-tributylstannylbut-3-en-2-yl]oxiran-2-yl]methoxy]silane |
| SMILES | CCCC[Sn](/C=C/[C@H](C)[C@@H]1O[C@@]1(C)CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C14H27O2Si.3C4H9.Sn/c1-9-11(2)12-14(6,16-12)10-15-17(7,8)13(3,4)5;3*1-3-4-2;/h1,9,11-12H,10H2,2-8H3;3*1,3-4H2,2H3;/t11-,12-,14-;;;;/m0..../s1 |
| InChIKey | FHWHDEBXFSDSPI-QGHSGEOSSA-N |
| XLogP | 8.75 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|