C22H46O3Si2 — CID 11058771
[(2S,3S)-2-but-3-enoxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11058771) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is [(2S,3S)-2-but-3-enoxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S)-2-but-3-enoxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11058771 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | [(2S,3S)-2-but-3-enoxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CCCO[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](CC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-13-15-17-23-20(18-24-26(9,10)21(3,4)5)19(16-14-2)25-27(11,12)22(6,7)8/h13-14,19-20H,1-2,15-18H2,3-12H3/t19-,20-/m0/s1 |
| InChIKey | IYBMKFVOPLYHKZ-PMACEKPBSA-N |
| XLogP | 6.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|