C20H40O2Si — CID 102239080
ditert-butyl-[(E)-hex-1-enyl]-[[(2R,3R)-3-propyloxiran-2-yl]methoxy]silane (PubChem CID 102239080) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is ditert-butyl-[(E)-hex-1-enyl]-[[(2R,3R)-3-propyloxiran-2-yl]methoxy]silane.
| Compound Name | ditert-butyl-[(E)-hex-1-enyl]-[[(2R,3R)-3-propyloxiran-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 102239080 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | ditert-butyl-[(E)-hex-1-enyl]-[[(2R,3R)-3-propyloxiran-2-yl]methoxy]silane |
| SMILES | CCCC/C=C/[Si](OC[C@H]1O[C@@H]1CCC)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-9-11-12-13-15-23(19(3,4)5,20(6,7)8)21-16-18-17(22-18)14-10-2/h13,15,17-18H,9-12,14,16H2,1-8H3/b15-13+/t17-,18-/m1/s1 |
| InChIKey | UGYLSYSSBBNZBM-ZWOQHNGQSA-N |
| XLogP | 6.40 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|