C18H36O2Si2 — CID 138968662
tert-butyl-dimethyl-[(1S,3Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hepta-3,6-dienoxy]silane (PubChem CID 138968662) has the molecular formula C18H36O2Si2 and a molecular weight of 340.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,3Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hepta-3,6-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S,3Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hepta-3,6-dienoxy]silane |
|---|---|
| PubChem CID | 138968662 |
| Molecular Formula | C18H36O2Si2 |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,3Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hepta-3,6-dienoxy]silane |
| SMILES | C=CC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C18H36O2Si2/c1-10-11-12-13-14-15(16-17(19-16)21(5,6)7)20-22(8,9)18(2,3)4/h10,12-13,15-17H,1,11,14H2,2-9H3/b13-12-/t15-,16-,17-/m0/s1 |
| InChIKey | QTYIVKVRLCEPHS-UESNHRRGSA-N |
| XLogP | 5.54 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|