C26H54O3Si3 — CID 138968658
[3-[(3Z,6Z)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,6-dienyl]oxiran-2-yl]-trimethylsilane (PubChem CID 138968658) has the molecular formula C26H54O3Si3 and a molecular weight of 498.97 g/mol. Its IUPAC name is [3-[(3Z,6Z)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,6-dienyl]oxiran-2-yl]-trimethylsilane.
| Compound Name | [3-[(3Z,6Z)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,6-dienyl]oxiran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 138968658 |
| Molecular Formula | C26H54O3Si3 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | [3-[(3Z,6Z)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,6-dienyl]oxiran-2-yl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C\C/C=C\CC(O[Si](C)(C)C(C)(C)C)C1OC1[Si](C)(C)C |
| InChI | InChI=1S/C26H54O3Si3/c1-25(2,3)31(10,11)27-21-19-17-15-14-16-18-20-22(23-24(28-23)30(7,8)9)29-32(12,13)26(4,5)6/h15-18,22-24H,14,19-21H2,1-13H3/b17-15-,18-16- |
| InChIKey | IIYCIXIDQAUTCI-IQRFGFHNSA-N |
| XLogP | 8.33 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|