C18H40O2Si2 — CID 134940445
tert-butyl-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-dimethylsilane (PubChem CID 134940445) has the molecular formula C18H40O2Si2 and a molecular weight of 344.69 g/mol. Its IUPAC name is tert-butyl-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134940445 |
| Molecular Formula | C18H40O2Si2 |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | tert-butyl-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyhex-5-enoxy]-dimethylsilane |
| SMILES | C=CC[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H40O2Si2/c1-12-13-16(20-22(10,11)18(5,6)7)14-15-19-21(8,9)17(2,3)4/h12,16H,1,13-15H2,2-11H3/t16-/m0/s1 |
| InChIKey | ULXUZWLOTALPDX-INIZCTEOSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|