C14H32O3Si2 — CID 91736917
but-3-enoxy-[dimethyl(4-methylpentoxy)silyl]oxy-dimethylsilane (PubChem CID 91736917) has the molecular formula C14H32O3Si2 and a molecular weight of 304.58 g/mol. Its IUPAC name is but-3-enoxy-[dimethyl(4-methylpentoxy)silyl]oxy-dimethylsilane.
| Compound Name | but-3-enoxy-[dimethyl(4-methylpentoxy)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91736917 |
| Molecular Formula | C14H32O3Si2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | but-3-enoxy-[dimethyl(4-methylpentoxy)silyl]oxy-dimethylsilane |
| SMILES | C=CCCO[Si](C)(C)O[Si](C)(C)OCCCC(C)C |
| InChI | InChI=1S/C14H32O3Si2/c1-8-9-12-15-18(4,5)17-19(6,7)16-13-10-11-14(2)3/h8,14H,1,9-13H2,2-7H3 |
| InChIKey | ZCAKKKKDNJAXKE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|