C16H36O2Si2 — CID 134846128
triethyl-[(3S)-5-methyl-2-trimethylsilyloxyhex-1-en-3-yl]oxysilane (PubChem CID 134846128) has the molecular formula C16H36O2Si2 and a molecular weight of 316.63 g/mol. Its IUPAC name is triethyl-[(3S)-5-methyl-2-trimethylsilyloxyhex-1-en-3-yl]oxysilane.
| Compound Name | triethyl-[(3S)-5-methyl-2-trimethylsilyloxyhex-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 134846128 |
| Molecular Formula | C16H36O2Si2 |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | triethyl-[(3S)-5-methyl-2-trimethylsilyloxyhex-1-en-3-yl]oxysilane |
| SMILES | C=C(O[Si](C)(C)C)[C@H](CC(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H36O2Si2/c1-10-20(11-2,12-3)18-16(13-14(4)5)15(6)17-19(7,8)9/h14,16H,6,10-13H2,1-5,7-9H3/t16-/m0/s1 |
| InChIKey | FLSRMMUINDZQBT-INIZCTEOSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|