C13H27LiO2Si — CID 135083614
lithium (4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-olate (PubChem CID 135083614) has the molecular formula C13H27LiO2Si and a molecular weight of 250.38 g/mol. Its IUPAC name is lithium (4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-olate.
| Compound Name | lithium (4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-olate |
|---|---|
| PubChem CID | 135083614 |
| Molecular Formula | C13H27LiO2Si |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | lithium (4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-en-3-olate |
| SMILES | C=C(C)C([O-])[C@@H](C)CO[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C13H27O2Si.Li/c1-10(2)12(14)11(3)9-15-16(7,8)13(4,5)6;/h11-12H,1,9H2,2-8H3;/q-1;+1/t11-,12?;/m0./s1 |
| InChIKey | JOUQVJMHPLFOKP-YLIVSKOQSA-N |
| XLogP | -0.05 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|