C14H30OSi — CID 134967066
tert-butyl-[(2R,3R)-3,5-dimethylhex-5-en-2-yl]oxy-dimethylsilane (PubChem CID 134967066) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-3,5-dimethylhex-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-3,5-dimethylhex-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134967066 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | tert-butyl-[(2R,3R)-3,5-dimethylhex-5-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C(C)C[C@@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-11(2)10-12(3)13(4)15-16(8,9)14(5,6)7/h12-13H,1,10H2,2-9H3/t12-,13-/m1/s1 |
| InChIKey | ZSEMZEKRAWOEGA-CHWSQXEVSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|