C23H50O2SiSn — CID 138969958
(E,2S,3S,4S)-2,4-dimethyl-6-tributylstannyl-3-trimethylsilyloxyhex-5-en-1-ol (PubChem CID 138969958) has the molecular formula C23H50O2SiSn and a molecular weight of 505.45 g/mol. Its IUPAC name is (E,2S,3S,4S)-2,4-dimethyl-6-tributylstannyl-3-trimethylsilyloxyhex-5-en-1-ol.
| Compound Name | (E,2S,3S,4S)-2,4-dimethyl-6-tributylstannyl-3-trimethylsilyloxyhex-5-en-1-ol |
|---|---|
| PubChem CID | 138969958 |
| Molecular Formula | C23H50O2SiSn |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (E,2S,3S,4S)-2,4-dimethyl-6-tributylstannyl-3-trimethylsilyloxyhex-5-en-1-ol |
| SMILES | CCCC[Sn](/C=C/[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)CO)(CCCC)CCCC |
| InChI | InChI=1S/C11H23O2Si.3C4H9.Sn/c1-7-9(2)11(10(3)8-12)13-14(4,5)6;3*1-3-4-2;/h1,7,9-12H,8H2,2-6H3;3*1,3-4H2,2H3;/t9-,10-,11-;;;;/m0..../s1 |
| InChIKey | VPTSTPIFXLVKMJ-HFOVUPGXSA-N |
| XLogP | 7.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|