C30H60O2Si2 — CID 11168137
[(2E)-3,7-dimethyl-2-[1-tri(propan-2-yl)silyloxyethenyl]octa-2,6-dienoxy]-tri(propan-2-yl)silane (PubChem CID 11168137) has the molecular formula C30H60O2Si2 and a molecular weight of 508.98 g/mol. Its IUPAC name is [(2E)-3,7-dimethyl-2-[1-tri(propan-2-yl)silyloxyethenyl]octa-2,6-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [(2E)-3,7-dimethyl-2-[1-tri(propan-2-yl)silyloxyethenyl]octa-2,6-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11168137 |
| Molecular Formula | C30H60O2Si2 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | [(2E)-3,7-dimethyl-2-[1-tri(propan-2-yl)silyloxyethenyl]octa-2,6-dienoxy]-tri(propan-2-yl)silane |
| SMILES | C=C(O[Si](C(C)C)(C(C)C)C(C)C)/C(CO[Si](C(C)C)(C(C)C)C(C)C)=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H60O2Si2/c1-21(2)18-17-19-28(15)30(20-31-33(22(3)4,23(5)6)24(7)8)29(16)32-34(25(9)10,26(11)12)27(13)14/h18,22-27H,16-17,19-20H2,1-15H3/b30-28+ |
| InChIKey | NPDMARBPORPNOW-SJCQXOIGSA-N |
| XLogP | 10.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|