C26H51IO2Si2 — CID 102503133
tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-yl]oxy-dimethylsilane (PubChem CID 102503133) has the molecular formula C26H51IO2Si2 and a molecular weight of 578.77 g/mol. Its IUPAC name is tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102503133 |
| Molecular Formula | C26H51IO2Si2 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | tert-butyl-[(4S,5E,7S,8R,9E)-7-ethyl-10-iodo-5,9-dimethyl-8-triethylsilyloxydeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](CC)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/I |
| InChI | InChI=1S/C26H51IO2Si2/c1-13-18-24(28-30(11,12)26(8,9)10)21(6)19-23(14-2)25(22(7)20-27)29-31(15-3,16-4)17-5/h13,19-20,23-25H,1,14-18H2,2-12H3/b21-19+,22-20+/t23-,24-,25-/m0/s1 |
| InChIKey | XOAXTQBGPQELCX-RWQNLNEMSA-N |
| XLogP | 9.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|