C17H35IOSi — CID 134933973
tert-butyl-[(E,2R,3R,4S)-1-iodo-2,4,7-trimethyloct-5-en-3-yl]oxy-dimethylsilane (PubChem CID 134933973) has the molecular formula C17H35IOSi and a molecular weight of 410.46 g/mol. Its IUPAC name is tert-butyl-[(E,2R,3R,4S)-1-iodo-2,4,7-trimethyloct-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,3R,4S)-1-iodo-2,4,7-trimethyloct-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134933973 |
| Molecular Formula | C17H35IOSi |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | tert-butyl-[(E,2R,3R,4S)-1-iodo-2,4,7-trimethyloct-5-en-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CI |
| InChI | InChI=1S/C17H35IOSi/c1-13(2)10-11-14(3)16(15(4)12-18)19-20(8,9)17(5,6)7/h10-11,13-16H,12H2,1-9H3/b11-10+/t14-,15-,16+/m0/s1 |
| InChIKey | YVSAEWKAMUCCIN-DYVQMQCFSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|