C21H39IOSi — CID 134887168
tert-butyl-[(1E,5E,7E,11S)-1-iodo-5,11-dimethyltrideca-1,5,7-trien-4-yl]oxy-dimethylsilane (PubChem CID 134887168) has the molecular formula C21H39IOSi and a molecular weight of 462.53 g/mol. Its IUPAC name is tert-butyl-[(1E,5E,7E,11S)-1-iodo-5,11-dimethyltrideca-1,5,7-trien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,5E,7E,11S)-1-iodo-5,11-dimethyltrideca-1,5,7-trien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134887168 |
| Molecular Formula | C21H39IOSi |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | tert-butyl-[(1E,5E,7E,11S)-1-iodo-5,11-dimethyltrideca-1,5,7-trien-4-yl]oxy-dimethylsilane |
| SMILES | CC[C@H](C)CC/C=C/C=C(\C)C(C/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39IOSi/c1-9-18(2)14-11-10-12-15-19(3)20(16-13-17-22)23-24(7,8)21(4,5)6/h10,12-13,15,17-18,20H,9,11,14,16H2,1-8H3/b12-10+,17-13+,19-15+/t18-,20?/m0/s1 |
| InChIKey | PPHPMTSYICNPAE-SSRBKBCWSA-N |
| XLogP | 8.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|