C17H33IO2Si — CID 56930009
(4R,6R)-2,2-ditert-butyl-4-[(E,2R)-4-iodopent-3-en-2-yl]-6-methyl-1,3,2-dioxasilinane (PubChem CID 56930009) has the molecular formula C17H33IO2Si and a molecular weight of 424.44 g/mol. Its IUPAC name is (4R,6R)-2,2-ditert-butyl-4-[(E,2R)-4-iodopent-3-en-2-yl]-6-methyl-1,3,2-dioxasilinane.
| Compound Name | (4R,6R)-2,2-ditert-butyl-4-[(E,2R)-4-iodopent-3-en-2-yl]-6-methyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 56930009 |
| Molecular Formula | C17H33IO2Si |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (4R,6R)-2,2-ditert-butyl-4-[(E,2R)-4-iodopent-3-en-2-yl]-6-methyl-1,3,2-dioxasilinane |
| SMILES | C/C(I)=C\[C@@H](C)[C@H]1C[C@@H](C)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H33IO2Si/c1-12(10-13(2)18)15-11-14(3)19-21(20-15,16(4,5)6)17(7,8)9/h10,12,14-15H,11H2,1-9H3/b13-10+/t12-,14-,15-/m1/s1 |
| InChIKey | XGRKVFGJGWQRTN-KHYMHZASSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|