C20H37IOSi — CID 135030938
tert-butyl-[(1E,4R,5E)-1-iodo-2,6,10-trimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane (PubChem CID 135030938) has the molecular formula C20H37IOSi and a molecular weight of 448.51 g/mol. Its IUPAC name is tert-butyl-[(1E,4R,5E)-1-iodo-2,6,10-trimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,4R,5E)-1-iodo-2,6,10-trimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135030938 |
| Molecular Formula | C20H37IOSi |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | tert-butyl-[(1E,4R,5E)-1-iodo-2,6,10-trimethylundeca-1,5,9-trien-4-yl]oxy-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/[C@@H](C/C(C)=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H37IOSi/c1-16(2)11-10-12-17(3)13-19(14-18(4)15-21)22-23(8,9)20(5,6)7/h11,13,15,19H,10,12,14H2,1-9H3/b17-13+,18-15+/t19-/m0/s1 |
| InChIKey | QBOZPKXPQKFGJC-QIWDSASDSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|