C17H32O2Si — CID 10063181
(E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxyundec-2-en-6-yn-5-ol (PubChem CID 10063181) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxyundec-2-en-6-yn-5-ol.
| Compound Name | (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxyundec-2-en-6-yn-5-ol |
|---|---|
| PubChem CID | 10063181 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (E,4R,5S)-4-[tert-butyl(dimethyl)silyl]oxyundec-2-en-6-yn-5-ol |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C#CCCCC |
| InChI | InChI=1S/C17H32O2Si/c1-8-10-11-12-14-15(18)16(13-9-2)19-20(6,7)17(3,4)5/h9,13,15-16,18H,8,10-11H2,1-7H3/b13-9+/t15-,16+/m0/s1 |
| InChIKey | DVYJJQFBOMOJCZ-FKZVYCBESA-N |
| XLogP | 4.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|