C19H30O2Si — CID 134974570
(3R,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxytrideca-1,9-dien-4,6-diyn-3-ol (PubChem CID 134974570) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (3R,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxytrideca-1,9-dien-4,6-diyn-3-ol.
| Compound Name | (3R,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxytrideca-1,9-dien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 134974570 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | (3R,8S,9Z)-8-[tert-butyl(dimethyl)silyl]oxytrideca-1,9-dien-4,6-diyn-3-ol |
| SMILES | C=C[C@@H](O)C#CC#C[C@H](/C=C\CCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O2Si/c1-8-10-11-15-18(16-13-12-14-17(20)9-2)21-22(6,7)19(3,4)5/h9,11,15,17-18,20H,2,8,10H2,1,3-7H3/b15-11-/t17-,18+/m1/s1 |
| InChIKey | XAASSBDWRYVLRO-FXIGXVRNSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|